EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H52O2 |
| Net Charge | 0 |
| Average Mass | 432.733 |
| Monoisotopic Mass | 432.39673 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C29H52O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27-24-28(30)26-29(31)25-27/h24-26,30-31H,2-23H2,1H3 |
| InChIKey | OHTBGMREZYLZQD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apatococcus constipatus (WORMS:616640) | - | PubMed (11140535) | |
| Azotobacter vinelandii (ncbitaxon:354) | - | PubMed (457611) | Strain: ATCC 12837 |
| Betula papyrifera (ncbitaxon:3507) | bark (BTO:0001301) | PubMed (31580010) | |
| Triticum aestivum (ncbitaxon:4565) | - | PubMed (15241924) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-tricosylresorcinol (CHEBI:145969) has role bacterial metabolite (CHEBI:76969) |
| 5-tricosylresorcinol (CHEBI:145969) has role plant metabolite (CHEBI:76924) |
| 5-tricosylresorcinol (CHEBI:145969) is a 5-alkylresorcinol (CHEBI:52679) |
| IUPAC Name |
|---|
| 5-tricosylbenzene-1,3-diol |
| Synonyms | Source |
|---|---|
| 1,3-dihydroxy-5-n-tricosylbenzene | ChEBI |
| 1,3-dihydroxy-5-tricosylbenzene | ChEBI |
| 5-n-tricosylresorcinol | LIPID MAPS |
| 5-tricosyl-1,3-benzenediol | ChEBI |
| 5-tricosylresorcinol | HMDB |
| Manual Xrefs | Databases |
|---|---|
| FDB017907 | FooDB |
| HMDB0038524 | HMDB |
| LMPK15030006 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:70110-60-0 | ChemIDplus |
| Citations |
|---|