EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H40O2 |
| Net Charge | 0 |
| Average Mass | 348.571 |
| Monoisotopic Mass | 348.30283 |
| SMILES | CCCCCCCCCCCCCCCCCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C23H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-18-22(24)20-23(25)19-21/h18-20,24-25H,2-17H2,1H3 |
| InChIKey | BBGNINPPDHJETF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Propolis (ncbitaxon:931589) | - | PubMed (25432012) | |
| Secale cereale (ncbitaxon:4550) | - | PubMed (17542491) | |
| Triticum (ncbitaxon:4564) | - | DOI (/10.1016/j.foodchem.2011.07.023) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-heptadecylresorcinol (CHEBI:145967) has role antineoplastic agent (CHEBI:35610) |
| 5-heptadecylresorcinol (CHEBI:145967) has role plant metabolite (CHEBI:76924) |
| 5-heptadecylresorcinol (CHEBI:145967) is a 5-alkylresorcinol (CHEBI:52679) |
| IUPAC Name |
|---|
| 5-heptadecylbenzene-1,3-diol |
| Synonyms | Source |
|---|---|
| 1,3-dihydroxy-5-n-heptadecylbenzene | ChEBI |
| 5-n-heptadecylresorcinol | LIPID MAPS |
| 5-heptadecyl-1,3-benzenediol | ChEBI |
| 5-heptadecyl-1,3-dihydroxybenzene | ChEBI |
| 5-heptadecylresorcinol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB017915 | FooDB |
| HMDB0038530 | HMDB |
| LMPK15030003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2287460 | Reaxys |
| CAS:41442-57-3 | ChemIDplus |
| Citations |
|---|