EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O |
| Net Charge | 0 |
| Average Mass | 134.178 |
| Monoisotopic Mass | 134.07316 |
| SMILES | CC(=O)c1ccccc1C |
| InChI | InChI=1S/C9H10O/c1-7-5-3-4-6-9(7)8(2)10/h3-6H,1-2H3 |
| InChIKey | YXWWHNCQZBVZPV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium coprophilum (ncbitaxon:36646) | - | PubMed (2641484) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-methylacetophenone (CHEBI:145958) has role acaricide (CHEBI:22153) |
| 2'-methylacetophenone (CHEBI:145958) has role flavouring agent (CHEBI:35617) |
| 2'-methylacetophenone (CHEBI:145958) has role fungal metabolite (CHEBI:76946) |
| 2'-methylacetophenone (CHEBI:145958) is a acetophenones (CHEBI:22187) |
| 2'-methylacetophenone (CHEBI:145958) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 1-(2-methylphenyl)ethanone |
| Synonyms | Source |
|---|---|
| 1-(2-methylphenyl)ethan-1-one | IUPAC |
| 1-(2-tolyl)ethanone | ChEBI |
| 1-(o-tolyl)ethan-1-one | ChEBI |
| 1-(o-tolyl)ethanone | ChEBI |
| 2-acetyltoluene | ChemIDplus |
| 2-methylacetophenone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:907005 | Reaxys |
| CAS:26444-19-9 | ChemIDplus |
| CAS:577-16-2 | ChemIDplus |
| CAS:577-16-2 | NIST Chemistry WebBook |
| Citations |
|---|