EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:145950 |
| ChEBI Name | nigerone |
| Stars | |
| Definition | A biaryl resulting from the formal oxidative dimerisation of two molecules of 5-hydroxy-6,8-dimethoxy-2-methyl-4H-benzo[g]chromen-4-one to form a single bond linking position 10 of each moiety (the 10Ra enantiomer). |
| Last Modified | 5 February 2020 |
| Submitter | Kristian Axelsen |
| Downloads |
| Formula | C32H26O10 |
| Net Charge | 0 |
| Average Mass | 570.550 |
| Monoisotopic Mass | 570.15260 |
| SMILES | COc1cc(OC)c2c(O)c3c(=O)cc(C)oc3c(-c3c4cc(OC)cc(OC)c4c(O)c4c(=O)cc(C)oc34)c2c1 |
| InChI | InChI=1S/C32H26O10/c1-13-7-19(33)27-29(35)23-17(9-15(37-3)11-21(23)39-5)25(31(27)41-13)26-18-10-16(38-4)12-22(40-6)24(18)30(36)28-20(34)8-14(2)42-32(26)28/h7-12,35-36H,1-6H3 |
| InChIKey | MBDIPBHBEVOYQB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. mycotoxin Poisonous substance produced by fungi. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigerone (CHEBI:145950) has role Aspergillus metabolite (CHEBI:76956) |
| nigerone (CHEBI:145950) has role antifungal agent (CHEBI:35718) |
| nigerone (CHEBI:145950) has role mycotoxin (CHEBI:25442) |
| nigerone (CHEBI:145950) is a benzochromenone (CHEBI:64986) |
| nigerone (CHEBI:145950) is a biaryl (CHEBI:64459) |
| nigerone (CHEBI:145950) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (10Ra)-5,5'-dihydroxy-6,6',8,8'-tetramethoxy-2,2'-dimethyl-4H,4'H-[10,10'-bibenzo[g]chromene]-4,4'-dione |
| UniProt Name | Source |
|---|---|
| nigerone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| FDB011548 | FooDB |
| HMDB0033496 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:76069-41-5 | ChemIDplus |
| Citations |
|---|