EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H45O3 |
| Net Charge | -1 |
| Average Mass | 429.665 |
| Monoisotopic Mass | 429.33742 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]1(C)CCC1C2=CC[C@@]2([H])[C@H](C(=O)[O-])[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C28H46O3/c1-17(2)7-6-8-18(3)20-11-12-21-19-9-10-23-25(26(30)31)24(29)14-16-28(23,5)22(19)13-15-27(20,21)4/h9,17-18,20-25,29H,6-8,10-16H2,1-5H3,(H,30,31)/p-1/t18-,20-,21+,22?,23+,24+,25+,27-,28-/m1/s1 |
| InChIKey | FXBZYWGMTFSORP-DWAJTJKJSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4α-carboxy-5α-cholest-7-en-3β-ol(1−) (CHEBI:145943) is a steroid acid anion (CHEBI:50160) |
| 4α-carboxy-5α-cholest-7-en-3β-ol(1−) (CHEBI:145943) is tautomer of 3β-hydroxy-5α-cholest-8-ene-4α-carboxylate (CHEBI:87055) |
| Incoming Relation(s) |
| 3β-hydroxy-5α-cholest-8-ene-4α-carboxylate (CHEBI:87055) is tautomer of 4α-carboxy-5α-cholest-7-en-3β-ol(1−) (CHEBI:145943) |
| Synonym | Source |
|---|---|
| 3β-hydroxy-5α-cholest-7-ene-4α-carboxylate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 4α-carboxy-5α-cholest-7-en-3β-ol | UniProt |
| Citations |
|---|