EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O6 |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | COC1=C(O)c2c(O)cc(C)c3c4c(c(O)c(c23)C1=O)C(C)(C)[C@@H](C)O4 |
| InChI | InChI=1S/C20H20O6/c1-7-6-9(21)11-12-10(7)18-14(20(3,4)8(2)26-18)15(22)13(12)17(24)19(25-5)16(11)23/h6,8,21-23H,1-5H3/t8-/m1/s1 |
| InChIKey | VZWSSCQUCMSKLE-MRVPVSSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium herquei (ncbitaxon:69774) | - | Article (Book: Dictionary of Antibiotics & Related Substances, Barrie W. Bycroft, 1987, pg 261.) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deoxyherqueinone (CHEBI:145901) has role antibacterial agent (CHEBI:33282) |
| deoxyherqueinone (CHEBI:145901) has role fungal metabolite (CHEBI:76946) |
| deoxyherqueinone (CHEBI:145901) is a enone (CHEBI:51689) |
| deoxyherqueinone (CHEBI:145901) is a organic heterotetracyclic compound (CHEBI:38163) |
| deoxyherqueinone (CHEBI:145901) is a phenols (CHEBI:33853) |
| deoxyherqueinone (CHEBI:145901) is a polyketide (CHEBI:26188) |
| deoxyherqueinone (CHEBI:145901) is conjugate acid of deoxyherqueinone(1−) (CHEBI:145874) |
| Incoming Relation(s) |
| deoxyherqueinone(1−) (CHEBI:145874) is conjugate base of deoxyherqueinone (CHEBI:145901) |
| IUPAC Name |
|---|
| (9R)-3,4,7-trihydroxy-5-methoxy-1,8,8,9-tetramethyl-8,9-dihydro-6H-phenaleno[1,2-b]furan-6-one |
| Synonyms | Source |
|---|---|
| (9R)-8,9-dihydro-3,4,7-trihydroxy-5-methoxy-1,8,8,9-tetramethyl-6H-phenaleno[1,2-b]furan-6-one | ChEBI |
| (R)-8,9-dihydro-3,4,7-trihydroxy-5-methoxy-1,8,8,9-tetramethyl-6H-phenaleno[1,2-b]furan-6-one | ChEBI |
| (+)-deoxyherqueinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:20887-73-4 | ChemIDplus |
| Citations |
|---|