EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27N2O2 |
| Net Charge | +1 |
| Average Mass | 315.437 |
| Monoisotopic Mass | 315.20670 |
| SMILES | [H][C@@]12C[NH+](C)[C@@]3([H])CC4=C[C@@]([H])(C(=O)CC4)[C@@]4([H])C(=O)CC[C@]([H])(C1)[C@]4([H])N2C3 |
| InChI | InChI=1S/C19H26N2O2/c1-20-9-14-8-12-3-5-17(23)18-15-7-11(2-4-16(15)22)6-13(20)10-21(14)19(12)18/h7,12-15,18-19H,2-6,8-10H2,1H3/p+1/t12-,13+,14+,15+,18+,19+/m1/s1 |
| InChIKey | UFKNDVKQCSBIQE-OCANJJRCSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| herquline A(1+) (CHEBI:145880) is a tertiary ammonium ion (CHEBI:137982) |
| herquline A(1+) (CHEBI:145880) is conjugate acid of herquline A (CHEBI:229724) |
| Incoming Relation(s) |
| (1S,7R,8R,14S)-6,9-dioxo-15,17-diazatetracyclo[12.2.2.13,7.18,12]icosa-3(20),12(19)-dien-15-ium (CHEBI:146146) has functional parent herquline A(1+) (CHEBI:145880) |
| (1S,8R,14S)-6,9-dioxo-15,17-diazatetracyclo[12.2.2.13,7.18,12]icosa-3(20),4,6,10,12(19)-tetraen-17-ium-7-ide (CHEBI:146147) has functional parent herquline A(1+) (CHEBI:145880) |
| herquline A (CHEBI:229724) is conjugate base of herquline A(1+) (CHEBI:145880) |
| IUPAC Name |
|---|
| (2S,5S,11R,11aR,14aR,14bS)-16-methyl-10,12-dioxotetradecahydro-4H-5,2-(epiminomethano)-11,7-(metheno)azacycloundecino[3,2,1-hi]indol-16-ium |
| Synonym | Source |
|---|---|
| herquline A cation | ChEBI |
| UniProt Name | Source |
|---|---|
| herquline A | UniProt |
| Citations |
|---|