EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24ClF4N5O5S2 |
| Net Charge | 0 |
| Average Mass | 650.076 |
| Monoisotopic Mass | 649.08435 |
| SMILES | [H][C@@]1(c2c(Cl)cccc2OS(C)(=O)=O)CC(c2csc(C3CCN(C(=O)Cn4nc(C(F)F)cc4C(F)F)CC3)n2)=NO1 |
| InChI | InChI=1S/C25H24ClF4N5O5S2/c1-42(37,38)40-19-4-2-3-14(26)22(19)20-10-15(33-39-20)17-12-41-25(31-17)13-5-7-34(8-6-13)21(36)11-35-18(24(29)30)9-16(32-35)23(27)28/h2-4,9,12-13,20,23-24H,5-8,10-11H2,1H3/t20-/m0/s1 |
| InChIKey | ZEXXEODAXHSRDJ-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Biological Role: | fungicide A substance used to destroy fungal pests. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-fluoxapiprolin (CHEBI:145869) has role fungicide (CHEBI:24127) |
| (S)-fluoxapiprolin (CHEBI:145869) is a 2-[(ethanesulfonyl)amino]-5-fluoro-4-[4-methyl-5-oxo-3-(trifluoromethyl)-4,5-dihydro-1H-1,2,4-triazol-1-yl]benzene-1-carbothioamide (CHEBI:145867) |
| (S)-fluoxapiprolin (CHEBI:145869) is enantiomer of (R)-fluoxapiprolin (CHEBI:145868) |
| Incoming Relation(s) |
| fluoxapiprolin (CHEBI:145866) has part (S)-fluoxapiprolin (CHEBI:145869) |
| (R)-fluoxapiprolin (CHEBI:145868) is enantiomer of (S)-fluoxapiprolin (CHEBI:145869) |
| IUPAC Name |
|---|
| 2-{(5S)-3-[2-(1-{[3,5-bis(difluoromethyl)-1H-pyrazol-1-yl]acetyl}piperidin-4-yl)-1,3-thiazol-4-yl]-4,5-dihydro-1,2-oxazol-5-yl}-3-chlorophenyl methanesulfonate |