EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13F4N5O3S2 |
| Net Charge | 0 |
| Average Mass | 427.405 |
| Monoisotopic Mass | 427.03959 |
| SMILES | CCS(=O)(=O)Nc1cc(-n2nc(C(F)(F)F)n(C)c2=O)c(F)cc1C(N)=S |
| InChI | InChI=1S/C13H13F4N5O3S2/c1-3-27(24,25)20-8-5-9(7(14)4-6(8)10(18)26)22-12(23)21(2)11(19-22)13(15,16)17/h4-5,20H,3H2,1-2H3,(H2,18,26) |
| InChIKey | LVKBXDHACCFCTA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bencarbazone (CHEBI:145865) has role agrochemical (CHEBI:33286) |
| bencarbazone (CHEBI:145865) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| bencarbazone (CHEBI:145865) has role herbicide (CHEBI:24527) |
| bencarbazone (CHEBI:145865) is a monofluorobenzenes (CHEBI:83575) |
| bencarbazone (CHEBI:145865) is a sulfonamide (CHEBI:35358) |
| bencarbazone (CHEBI:145865) is a thiocarboxamide (CHEBI:47956) |
| bencarbazone (CHEBI:145865) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 2-[(ethylsulfonyl)amino]-5-fluoro-4-[4-methyl-5-oxo-3-(trifluoromethyl)-4,5-dihydro-1H-1,2,4-triazol-1-yl]benzenecarbothioamide |
| Synonyms | Source |
|---|---|
| 2-[(ethanesulfonyl)amino]-5-fluoro-4-[4-methyl-5-oxo-3-(trifluoromethyl)-4,5-dihydro-1H-1,2,4-triazol-1-yl]benzene-1-carbothioamide | IUPAC |
| HWH 4991 | PPDB |
| HWH-4991 | ChEBI |
| TM 435 | ChEBI |
| TM-435 | PPDB |
| 4-[4,5-dihydro-4-methyl-5-oxo-3-(trifluoromethyl)-1H-1,2,4-triazol-1-yl]-2-[(ethylsulfonyl)amino]-5-fluorobenzenecarbothioamide | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Midas | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| bencarbazone | Alan Wood's Pesticides |
| 1697 | PPDB |
| WO9733876 | Patent |
| US6451736 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14343224 | Reaxys |
| CAS:173980-17-1 | ChemIDplus |