EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38 |
| Net Charge | 0 |
| Average Mass | 278.524 |
| Monoisotopic Mass | 278.29735 |
| SMILES | C=CC(=C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H38/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h7,17,19-20H,1,4,8-16H2,2-3,5-6H3 |
| InChIKey | NIDGCIPAMWNKOA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alhagi canescens (IPNI:473467-1) | aerial part (BTO:0001658) | PubMed (29770713) | |
| Centaurium erythraea (ncbitaxon:172057) | aerial part (BTO:0001658) | PubMed (22349896) | |
| Jatropha curcas (ncbitaxon:180498) | leaf (BTO:0000713) | PubMed (30549905) | |
| Mentha pulegium (ncbitaxon:294739) | leaf (BTO:0000713) | PubMed (29261270) | |
| Pimpinella anisum (ncbitaxon:271192) | fruit (BTO:0000486) | DOI (/10.1007/BF01959777) | |
| Tagetes erecta (ncbitaxon:13708) | leaf (BTO:0000713) | DOI (/10.1016/j.indcrop.2018.10.013) | |
| Turbinaria ornata (ncbitaxon:86657) | - | PubMed (31981060) | |
| Ulva lactuca (ncbitaxon:63410) | - | PubMed (31678034) |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neophytadiene (CHEBI:145817) has role algal metabolite (CHEBI:84735) |
| neophytadiene (CHEBI:145817) has role anti-inflammatory agent (CHEBI:67079) |
| neophytadiene (CHEBI:145817) has role antimicrobial agent (CHEBI:33281) |
| neophytadiene (CHEBI:145817) has role plant metabolite (CHEBI:76924) |
| neophytadiene (CHEBI:145817) is a alkene (CHEBI:32878) |
| neophytadiene (CHEBI:145817) is a diterpene (CHEBI:35190) |
| IUPAC Name |
|---|
| 7,11,15-trimethyl-3-methylidenehexadec-1-ene |
| Synonyms | Source |
|---|---|
| 2-(4,8,12-trimethyltridecyl)-1,3-butadiene | ChemIDplus |
| 2-(4,8,12-trimethyltridecyl)buta-1,3-diene | ChemIDplus |
| 3-methylene-7,11,15-trimethyl-1-hexadecene | ChEBI |
| 3-methylene-7,11,15-trimethylhexadec-1-ene | ChEBI |
| 7,11,15-trimethyl-3-methylene-1-hexadecene | ChemIDplus |
| Citations |
|---|