EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:145800 |
| ChEBI Name | AS1842856 |
| Stars | |
| Definition | A quinolone that is 4-quinolone substituted at positions 1, 3, 5, 6 and 7 by ethyl, carboxy, amino, fluorine, and cyclohexylamino groups, respectively. It can directly bind to and block the transcription activity of the active forkhead box protein O1 (Foxo1), but not the Ser256-phosphorylated form. It induces cell death and growth arrest in Burkitt lymphoma cell lines at low concentrations. |
| Last Modified | 15 January 2020 |
| Submitter | sabrina, zfin |
| Downloads |
| Formula | C18H22FN3O3 |
| Net Charge | 0 |
| Average Mass | 347.390 |
| Monoisotopic Mass | 347.16452 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2c(N)c(F)c(NC3CCCCC3)cc21 |
| InChI | InChI=1S/C18H22FN3O3/c1-2-22-9-11(18(24)25)17(23)14-13(22)8-12(15(19)16(14)20)21-10-6-4-3-5-7-10/h8-10,21H,2-7,20H2,1H3,(H,24,25) |
| InChIKey | MOMCHYGXXYBDCD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). forkhead box protein O1 inhibitor Any inhibitor that acts on forkhead box protein O1 (FOXO1). anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AS1842856 (CHEBI:145800) has role anti-obesity agent (CHEBI:74518) |
| AS1842856 (CHEBI:145800) has role antineoplastic agent (CHEBI:35610) |
| AS1842856 (CHEBI:145800) has role apoptosis inducer (CHEBI:68495) |
| AS1842856 (CHEBI:145800) has role autophagy inhibitor (CHEBI:88230) |
| AS1842856 (CHEBI:145800) has role forkhead box protein O1 inhibitor (CHEBI:145807) |
| AS1842856 (CHEBI:145800) has role hypoglycemic agent (CHEBI:35526) |
| AS1842856 (CHEBI:145800) is a organofluorine compound (CHEBI:37143) |
| AS1842856 (CHEBI:145800) is a primary amino compound (CHEBI:50994) |
| AS1842856 (CHEBI:145800) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| AS1842856 (CHEBI:145800) is a quinolone (CHEBI:23765) |
| AS1842856 (CHEBI:145800) is a secondary amino compound (CHEBI:50995) |
| AS1842856 (CHEBI:145800) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 5-amino-7-(cyclohexylamino)-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5-amino-7-(cyclohexylamino)-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid | SUBMITTER |
| AS 1842856 | ChEBI |
| AS-1842856 | ChEBI |
| FOXO1 inhibitor | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:836620-48-5 | SUBMITTER |
| Citations |
|---|