EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:145800 - AS1842856
| ChEBI ID | CHEBI:145800 |
| ChEBI Name | AS1842856 |
| Stars | |
| Definition | A quinolone that is 4-quinolone substituted at positions 1, 3, 5, 6 and 7 by ethyl, carboxy, amino, fluorine, and cyclohexylamino groups, respectively. It can directly bind to and block the transcription activity of the active forkhead box protein O1 (Foxo1), but not the Ser256-phosphorylated form. It induces cell death and growth arrest in Burkitt lymphoma cell lines at low concentrations. |
| Last Modified | 15 January 2020 |
| Submitter | sabrina, zfin |
| Downloads |
| Formula | C18H22FN3O3 |
| Net Charge | 0 |
| Average Mass | 347.390 |
| Monoisotopic Mass | 347.16452 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2c(N)c(F)c(NC3CCCCC3)cc21 |
| InChI | InChI=1S/C18H22FN3O3/c1-2-22-9-11(18(24)25)17(23)14-13(22)8-12(15(19)16(14)20)21-10-6-4-3-5-7-10/h8-10,21H,2-7,20H2,1H3,(H,24,25) |
| InChIKey | MOMCHYGXXYBDCD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. forkhead box protein O1 inhibitor Any inhibitor that acts on forkhead box protein O1 (FOXO1). autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AS1842856 (CHEBI:145800) has role anti-obesity agent (CHEBI:74518) |
| AS1842856 (CHEBI:145800) has role antineoplastic agent (CHEBI:35610) |
| AS1842856 (CHEBI:145800) has role apoptosis inducer (CHEBI:68495) |
| AS1842856 (CHEBI:145800) has role autophagy inhibitor (CHEBI:88230) |
| AS1842856 (CHEBI:145800) has role forkhead box protein O1 inhibitor (CHEBI:145807) |
| AS1842856 (CHEBI:145800) has role hypoglycemic agent (CHEBI:35526) |
| AS1842856 (CHEBI:145800) is a organofluorine compound (CHEBI:37143) |
| AS1842856 (CHEBI:145800) is a primary amino compound (CHEBI:50994) |
| AS1842856 (CHEBI:145800) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| AS1842856 (CHEBI:145800) is a quinolone (CHEBI:23765) |
| AS1842856 (CHEBI:145800) is a secondary amino compound (CHEBI:50995) |
| AS1842856 (CHEBI:145800) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 5-amino-7-(cyclohexylamino)-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5-amino-7-(cyclohexylamino)-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid | SUBMITTER |
| AS 1842856 | ChEBI |
| AS-1842856 | ChEBI |
| FOXO1 inhibitor | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:836620-48-5 | SUBMITTER |
| Citations |
|---|