EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33O8 |
| Net Charge | -1 |
| Average Mass | 437.509 |
| Monoisotopic Mass | 437.21809 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@@H](O)C[C@@H](O)[C@]3(CO)[C@@]1([H])[C@H](O)C[C@]1(C)[C@@H](c3[c-]oc(=O)c3)CC[C@]21O |
| InChI | InChI=1S/C23H33O8/c1-20-9-16(26)19-15(23(20,30)5-3-14(20)12-6-18(28)31-10-12)2-4-21(29)8-13(25)7-17(27)22(19,21)11-24/h6,10,13-17,19,24-27,29-30H,2-5,7-9,11H2,1H3/q-1/t13-,14+,15+,16+,17+,19+,20+,21-,22+,23-/m0/s1 |
| InChIKey | RPGXJNPPWHRVMA-QOHCMMFCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ouabagenin(1−) (CHEBI:145799) is a organic anion (CHEBI:25696) |
| ouabagenin(1−) (CHEBI:145799) is conjugate base of ouabagenin (CHEBI:71016) |
| Incoming Relation(s) |
| ouabagenin (CHEBI:71016) is conjugate acid of ouabagenin(1−) (CHEBI:145799) |
| IUPAC Name |
|---|
| 1β,3β,5,11α,14,19-hexahydroxy-17β-(5-oxo-2,5-dihydrofuran-2-id-3-yl)-5β,14β-androstane |
| Synonym | Source |
|---|---|
| ouabagenin anion | ChEBI |
| UniProt Name | Source |
|---|---|
| ouabagenin | UniProt |
| Citations |
|---|