EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H43O12 |
| Net Charge | -1 |
| Average Mass | 583.651 |
| Monoisotopic Mass | 583.27600 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@@H](O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)C[C@@H](O)[C@]3(CO)[C@@]1([H])[C@H](O)C[C@]1(C)[C@@H](c3[c-]oc(=O)c3)CC[C@]21O |
| InChI | InChI=1S/C29H43O12/c1-13-22(34)23(35)24(36)25(40-13)41-15-8-19(32)28(12-30)21-17(3-5-27(28,37)9-15)29(38)6-4-16(14-7-20(33)39-11-14)26(29,2)10-18(21)31/h7,11,13,15-19,21-25,30-32,34-38H,3-6,8-10,12H2,1-2H3/q-1/t13-,15-,16+,17+,18+,19+,21+,22-,23+,24+,25-,26+,27-,28+,29-/m0/s1 |
| InChIKey | MPLJNVZJPLASQC-HBYQJFLCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ouabain(1−) (CHEBI:145798) is a organic anion (CHEBI:25696) |
| ouabain(1−) (CHEBI:145798) is conjugate base of ouabain (CHEBI:472805) |
| Incoming Relation(s) |
| ouabain (CHEBI:472805) is conjugate acid of ouabain(1−) (CHEBI:145798) |
| IUPAC Name |
|---|
| 1β,5,11α,14,19-pentahydroxy-17β-(5-oxo-2,5-dihydrofuran-2-id-3-yl)-5β,14β-androstan-3β-yl 6-deoxy-α-L-mannopyranoside |
| Synonym | Source |
|---|---|
| ouabain anion | ChEBI |
| UniProt Name | Source |
|---|---|
| ouabain | UniProt |
| Citations |
|---|