EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O8 |
| Net Charge | 0 |
| Average Mass | 332.264 |
| Monoisotopic Mass | 332.05322 |
| SMILES | COc1cc(O)c2c(=O)c(O)c(-c3cc(O)c(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C16H12O8/c1-23-7-4-8(17)12-11(5-7)24-16(15(22)14(12)21)6-2-9(18)13(20)10(19)3-6/h2-5,17-20,22H,1H3 |
| InChIKey | BDZXSHDKBKYQKJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plumbago europaea (ncbitaxon:114226) | leaf (BTO:0000713) | DOI (10.1016/S0031-9422(00)82884-8) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-O-methylmyricetin (CHEBI:145786) has functional parent myricetin (CHEBI:18152) |
| 7-O-methylmyricetin (CHEBI:145786) has role plant metabolite (CHEBI:76924) |
| 7-O-methylmyricetin (CHEBI:145786) is a monomethoxyflavone (CHEBI:25401) |
| 7-O-methylmyricetin (CHEBI:145786) is a pentahydroxyflavone (CHEBI:25883) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-7-methoxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,5-dihydroxy-7-methoxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one | IUPAC |
| 7-methylmyricetin | ChEBI |
| europetin | LIPID MAPS |
| myricetin 7-O-methyl ether | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| C00004761 | KNApSAcK |
| CPD-14933 | MetaCyc |
| Europetin | Wikipedia |
| LMPK12112664 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:16280-27-6 | ChEBI |
| Citations |
|---|