EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O3 |
| Net Charge | 0 |
| Average Mass | 244.250 |
| Monoisotopic Mass | 244.08479 |
| SMILES | O=C(O)CNC(=O)/C=C/c1cnc2ccccc12 |
| InChI | InChI=1S/C13H12N2O3/c16-12(15-8-13(17)18)6-5-9-7-14-11-4-2-1-3-10(9)11/h1-7,14H,8H2,(H,15,16)(H,17,18)/b6-5+ |
| InChIKey | DUIFVCFSAWHIOD-AATRIKPKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indolylacryloylglycine (CHEBI:145761) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| HMDB0006005 | HMDB |
| Indolyl-3-acryloylglycine | Wikipedia |