EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:145738 - γ-octalactone
| Formula | C8H14O2 |
| Net Charge | 0 |
| Average Mass | 142.198 |
| Monoisotopic Mass | 142.09938 |
| SMILES | CCCCC1CCC(=O)O1 |
| InChI | InChI=1S/C8H14O2/c1-2-3-4-7-5-6-8(9)10-7/h7H,2-6H2,1H3 |
| InChIKey | IPBFYZQJXZJBFQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | - | PubMed (21823126) | |
| Mus spicilegus (ncbitaxon:10103) | urine (BTO:0001419) | PubMed (19390894) | |
| Prunus persica (ncbitaxon:3760) | - | DOI (10.1007/s10886-014-0379-3) | Found in ripe peach with leaves. |
| Sus scrofa domesticus (ncbitaxon:9825) | - | DOI (10.1007/s00217-006-0465-z) | |
| Bos taurus (ncbitaxon:9913) | - | PubMed (21535590) | Found in the Longissimus Thoracis muscle. |
| Mangifera indica (ncbitaxon:29780) | - | PubMed (22438014) |
| Roles Classification |
|---|
| Biological Roles: | insect attractant A chemical that attracts insects. flavouring agent A food additive that is used to added improve the taste or odour of a food. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-octalactone (CHEBI:145738) has role flavouring agent (CHEBI:35617) |
| γ-octalactone (CHEBI:145738) has role fungal metabolite (CHEBI:76946) |
| γ-octalactone (CHEBI:145738) has role insect attractant (CHEBI:24850) |
| γ-octalactone (CHEBI:145738) has role mammalian metabolite (CHEBI:75768) |
| γ-octalactone (CHEBI:145738) has role mouse metabolite (CHEBI:75771) |
| γ-octalactone (CHEBI:145738) has role plant metabolite (CHEBI:76924) |
| γ-octalactone (CHEBI:145738) is a tetrahydrofuranone (CHEBI:47016) |
| γ-octalactone (CHEBI:145738) is a volatile organic compound (CHEBI:134179) |
| γ-octalactone (CHEBI:145738) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 5-butyldihydrofuran-2(3H)-one |
| Synonyms | Source |
|---|---|
| 5-butyloxolan-2-one | IUPAC |
| γ-octalactone | ChemIDplus |
| 5-butyldihydro-2(3H)-furanone | ChemIDplus |
| dihydro-5-butyl-2(3H)-furanone | ChemIDplus |
| 4-butyl-γ-butyrolactone | ChemIDplus |
| gamma-octalactone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0035422 | HMDB |
| LMFA07040016 | LIPID MAPS |
| FDB014100 | FooDB |
| Citations |
|---|