EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N6O6P |
| Net Charge | 0 |
| Average Mass | 412.343 |
| Monoisotopic Mass | 412.12602 |
| SMILES | Nc1ncnc2c1nc(N1CCCCC1)n2[C@@H]1O[C@@H]2COP(=O)(O)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C15H21N6O6P/c16-12-9-13(18-7-17-12)21(15(19-9)20-4-2-1-3-5-20)14-10(22)11-8(26-14)6-25-28(23,24)27-11/h7-8,10-11,14,22H,1-6H2,(H,23,24)(H2,16,17,18)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | KBRGEUZQYNIAKB-IDTAVKCVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | protein kinase A agonist A protein kinase agonist that selectively binds to and activates a protein kinase A receptor |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-PIP-cAMP (CHEBI:145730) has functional parent 3',5'-cyclic AMP (CHEBI:17489) |
| 8-PIP-cAMP (CHEBI:145730) has role antineoplastic agent (CHEBI:35610) |
| 8-PIP-cAMP (CHEBI:145730) has role protein kinase A agonist (CHEBI:78547) |
| 8-PIP-cAMP (CHEBI:145730) is a 3',5'-cyclic purine nucleotide (CHEBI:19834) |
| 8-PIP-cAMP (CHEBI:145730) is a adenyl ribonucleotide (CHEBI:61296) |
| 8-PIP-cAMP (CHEBI:145730) is a piperidines (CHEBI:26151) |
| 8-PIP-cAMP (CHEBI:145730) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 8-piperidin-1-yladenosine 3',5'-(hydrogen phosphate) |
| Synonyms | Source |
|---|---|
| (4aR,6R,7R,7aS)-6-[6-amino-8-(piperidin-1-yl)-9H-purin-9-yl]tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinine-2,7-diol 2-oxide | IUPAC |
| 8-piperidinoadenosine-3',5'-cyclic monophosphate | ChEBI |
| Citations |
|---|