EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N2OS |
| Net Charge | +1 |
| Average Mass | 339.484 |
| Monoisotopic Mass | 339.15256 |
| SMILES | C[C@@H](C(=O)N1c2ccccc2Sc2ccccc21)[N+]1(C)CCCC1 |
| InChI | InChI=1S/C20H23N2OS/c1-15(22(2)13-7-8-14-22)20(23)21-16-9-3-5-11-18(16)24-19-12-6-4-10-17(19)21/h3-6,9-12,15H,7-8,13-14H2,1-2H3/q+1/t15-/m0/s1 |
| InChIKey | YKNNBQKAAWCISH-HNNXBMFYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-propyromazine (CHEBI:145688) is a 1-methyl-1-[1-oxo-1-(10H-phenothiazin-10-yl)propan-2-yl]pyrrolidinium (CHEBI:145689) |
| (S)-propyromazine (CHEBI:145688) is enantiomer of (R)-propyromazine (CHEBI:145687) |
| Incoming Relation(s) |
| propyromazine (CHEBI:135439) has part (S)-propyromazine (CHEBI:145688) |
| (R)-propyromazine (CHEBI:145687) is enantiomer of (S)-propyromazine (CHEBI:145688) |
| IUPAC Name |
|---|
| 1-methyl-1-[(2S)-1-oxo-1-(10H-phenothiazin-10-yl)propan-2-yl]pyrrolidinium |
| Synonym | Source |
|---|---|
| 1-methyl-1-[(2S)-1-oxo-1-(10H-phenothiazin-10-yl)propan-2-yl]pyrrolidin-1-ium | IUPAC |