EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:145685 - notoamide C
| Formula | C26H31N3O4 |
| Net Charge | 0 |
| Average Mass | 449.551 |
| Monoisotopic Mass | 449.23146 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](C[C@@]1(C(C)(C)C=C)C(=O)Nc3c1ccc1c3C=CC(C)(C)O1)NC2=O |
| InChI | InChI=1S/C26H31N3O4/c1-6-24(2,3)26(14-17-22(31)29-13-7-8-18(29)21(30)27-17)16-9-10-19-15(20(16)28-23(26)32)11-12-25(4,5)33-19/h6,9-12,17-18H,1,7-8,13-14H2,2-5H3,(H,27,30)(H,28,32)/t17-,18-,26-/m0/s1 |
| InChIKey | KNFZHRYXLWKRSU-XWXLMPLOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . mycotoxin Poisonous substance produced by fungi. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antifouling biocide A compound that inhibits the growth of marine organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| notoamide C (CHEBI:145685) has role Aspergillus metabolite (CHEBI:76956) |
| notoamide C (CHEBI:145685) has role antifouling biocide (CHEBI:51076) |
| notoamide C (CHEBI:145685) has role mycotoxin (CHEBI:25442) |
| notoamide C (CHEBI:145685) is a dipeptide (CHEBI:46761) |
| notoamide C (CHEBI:145685) is a indole alkaloid (CHEBI:38958) |
| notoamide C (CHEBI:145685) is a notoamide (CHEBI:145690) |
| notoamide C (CHEBI:145685) is a organic heterotricyclic compound (CHEBI:26979) |
| notoamide C (CHEBI:145685) is a pyrrolopyrazine (CHEBI:48337) |
| IUPAC Name |
|---|
| (3S,8aS)-3-{[(3S)-7,7-dimethyl-3-(2-methylbut-3-en-2-yl)-2-oxo-1,2,3,7-tetrahydropyrano[2,3-g]indol-3-yl]methyl}hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| UniProt Name | Source |
|---|---|
| notoamide C | UniProt |
| Citations |
|---|