EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31N3O3 |
| Net Charge | 0 |
| Average Mass | 433.552 |
| Monoisotopic Mass | 433.23654 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](Cc1c(C(C)(C)C=C)nc3c4c(ccc13)OC(C)(C)C=C4)NC2=O |
| InChI | InChI=1S/C26H31N3O3/c1-6-25(2,3)22-17(14-18-24(31)29-13-7-8-19(29)23(30)27-18)15-9-10-20-16(21(15)28-22)11-12-26(4,5)32-20/h6,9-12,18-19,28H,1,7-8,13-14H2,2-5H3,(H,27,30)/t18-,19-/m0/s1 |
| InChIKey | FQFSPHHVEQZCED-OALUTQOASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mycotoxin Poisonous substance produced by fungi. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| notoamide E (CHEBI:145684) has functional parent notoamide S (CHEBI:145683) |
| notoamide E (CHEBI:145684) has role mycotoxin (CHEBI:25442) |
| notoamide E (CHEBI:145684) is a dipeptide (CHEBI:46761) |
| notoamide E (CHEBI:145684) is a notoamide (CHEBI:145690) |
| notoamide E (CHEBI:145684) is a pyranoindole (CHEBI:145700) |
| notoamide E (CHEBI:145684) is a pyrrolopyrazine (CHEBI:48337) |
| IUPAC Name |
|---|
| (3S,8aS)-3-{[7,7-dimethyl-2-(2-methylbut-3-en-2-yl)-1,7-dihydropyrano[2,3-g]indol-3-yl]methyl}hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| UniProt Name | Source |
|---|---|
| notoamide E | UniProt |
| Citations |
|---|