EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29N5O2 |
| Net Charge | 0 |
| Average Mass | 383.496 |
| Monoisotopic Mass | 383.23213 |
| SMILES | [H][C@@]12CC[C@@]([H])(C1)[C@@]1([H])C(=O)N(CCCCN3CCN(c4ncccn4)CC3)C(=O)[C@@]21[H] |
| InChI | InChI=1S/C21H29N5O2/c27-19-17-15-4-5-16(14-15)18(17)20(28)26(19)9-2-1-8-24-10-12-25(13-11-24)21-22-6-3-7-23-21/h3,6-7,15-18H,1-2,4-5,8-14H2/t15-,16+,17+,18- |
| InChIKey | CEIJFEGBUDEYSX-FZDBZEDMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tandospirone (CHEBI:145673) has role antidepressant (CHEBI:35469) |
| tandospirone (CHEBI:145673) has role anxiolytic drug (CHEBI:35474) |
| tandospirone (CHEBI:145673) is a N-alkylpiperazine (CHEBI:46845) |
| tandospirone (CHEBI:145673) is a N-arylpiperazine (CHEBI:46848) |
| tandospirone (CHEBI:145673) is a bridged compound (CHEBI:35990) |
| tandospirone (CHEBI:145673) is a dicarboximide (CHEBI:35356) |
| tandospirone (CHEBI:145673) is a pyrimidines (CHEBI:39447) |
| tandospirone (CHEBI:145673) is conjugate base of tandospirone(1+) (CHEBI:145674) |
| Incoming Relation(s) |
| tandospirone(1+) (CHEBI:145674) is conjugate acid of tandospirone (CHEBI:145673) |
| IUPAC Name |
|---|
| (3aR,4S,7R,7aS)-2-{4-[4-(pyrimidin-2-yl)piperazin-1-yl]butyl}hexahydro-1H-4,7-methanoisoindole-1,3(2H)-dione |
| INNs | Source |
|---|---|
| tandospirona | WHO MedNet |
| tandospirone | WHO MedNet |
| tandospirone | WHO MedNet |
| tandospironum | WHO MedNet |
| Synonyms | Source |
|---|---|
| SM 3997 | ChEBI |
| SM-3997 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2563 | DrugCentral |
| D08561 | KEGG DRUG |
| DB12833 | DrugBank |
| Tandospirone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:87760-53-0 | ChemIDplus |
| Citations |
|---|