EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:145672 - propyromazine bromide
| Formula | Br.C20H23N2OS |
| Net Charge | 0 |
| Average Mass | 419.388 |
| Monoisotopic Mass | 418.07145 |
| SMILES | CC(C(=O)N1c2ccccc2Sc2ccccc21)[N+]1(C)CCCC1.[Br-] |
| InChI | InChI=1S/C20H23N2OS.BrH/c1-15(22(2)13-7-8-14-22)20(23)21-16-9-3-5-11-18(16)24-19-12-6-4-10-17(19)21;/h3-6,9-12,15H,7-8,13-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | OANVFVBYPNXRLD-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propyromazine bromide (CHEBI:145672) has part propyromazine (CHEBI:135439) |
| propyromazine bromide (CHEBI:145672) has role antispasmodic drug (CHEBI:53784) |
| propyromazine bromide (CHEBI:145672) has role muscarinic antagonist (CHEBI:48876) |
| propyromazine bromide (CHEBI:145672) is a organic bromide salt (CHEBI:48369) |
| propyromazine bromide (CHEBI:145672) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| rac-1-methyl-1-[1-oxo-1-(10H-phenothiazin-10-yl)propan-2-yl]pyrrolidinium bromide |
| INNs | Source |
|---|---|
| propyromazine bromide | WHO MedNet |
| bromuro de propiromazina | WHO MedNet |
| bromure de propyromazine | WHO MedNet |
| propyromazini bromidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-methyl-1-[1-oxo-1-(10H-phenothiazin-10-yl)propan-2-yl]pyrrolidin-1-ium bromide | ChEBI |
| 1-methyl-1-[1-oxo-1-(10H-phenothiazin-10-yl)propan-2-yl]pyrrolidinium bromide | ChEBI |
| diaspasmol | ChemIDplus |
| diospasmyl | ChemIDplus |
| LD 335 | ChemIDplus |
| SD 104 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Diaspasmyl | ChemIDplus |
| Diamant | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:145-54-0 | ChemIDplus |
| Citations |
|---|