EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O2 |
| Net Charge | 0 |
| Average Mass | 276.420 |
| Monoisotopic Mass | 276.20893 |
| SMILES | [H][C@@]12CCC3=C[C@@H](O)CC[C@]3([H])[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C18H28O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,12-17,19-20H,2-9H2,1H3/t12-,13-,14+,15+,16-,17-,18-/m0/s1 |
| InChIKey | CMXKUJNZWYTFJN-XFUVECHXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | prohormone Any intra-glandular substance that acts as a precursor of a hormone, usually having minimal hormonal effect itself. Prohormones generally help in amplifying the effect of existing hormones. androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. anabolic agent A compound which stimulates anabolism and inhibits catabolism. Anabolic agents stimulate the development of muscle mass, strength, and power. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bolandiol (CHEBI:145661) has parent hydride estrane (CHEBI:23966) |
| bolandiol (CHEBI:145661) has role nutraceutical (CHEBI:50733) |
| bolandiol (CHEBI:145661) has role prohormone (CHEBI:71212) |
| bolandiol (CHEBI:145661) is a 17β-hydroxy steroid (CHEBI:35343) |
| bolandiol (CHEBI:145661) is a 3β-hydroxy steroid (CHEBI:36836) |
| bolandiol (CHEBI:145661) is a anabolic androgenic steroid (CHEBI:50786) |
| bolandiol (CHEBI:145661) is a diol (CHEBI:23824) |
| Incoming Relation(s) |
| bolandiol dipropionate (CHEBI:31297) has functional parent bolandiol (CHEBI:145661) |
| IUPAC Name |
|---|
| estr-4-ene-3β,17β-diol |
| INNs | Source |
|---|---|
| bolandiol | WHO MedNet |
| bolandiol | WHO MedNet |
| bolandiol | WHO MedNet |
| bolandiolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 19-nor-4-androstenediol | DrugBank |
| 19-norandrosta-4-ene-3β,17β-diol | ChEBI |
| 19-nortestosterone-3β,17β-diol | ChEBI |
| (1S,3aS,3bR,7S,9aR,9bS,11aS)-11a-methyl-2,3,3a,3b,4,5,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthrene-1,7-diol | ChEBI |
| 3β,17β-dihydroxyestr-4-ene | DrugBank |
| 3β-dihydronandrolone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:19793-20-5 | ChemIDplus |
| Citations |
|---|