EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23N6O15P3 |
| Net Charge | 0 |
| Average Mass | 656.331 |
| Monoisotopic Mass | 656.04342 |
| SMILES | CNc1ccccc1C(=O)O[C@H]1[C@@H](O)[C@H](n2cnc3c(=O)nc(N)nc32)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C18H23N6O15P3/c1-20-9-5-3-2-4-8(9)17(27)37-13-10(6-35-41(31,32)39-42(33,34)38-40(28,29)30)36-16(12(13)25)24-7-21-11-14(24)22-18(19)23-15(11)26/h2-5,7,10,12-13,16,20,25H,6H2,1H3,(H,31,32)(H,33,34)(H2,28,29,30)(H3,19,22,23,26)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | DSPRYHPLXXUNHS-XNIJJKJLSA-N |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-MANT-GTP (CHEBI:145576) has functional parent 3'-MANT-GDP (CHEBI:85434) |
| 3'-MANT-GTP (CHEBI:145576) has role fluorescent probe (CHEBI:39442) |
| 3'-MANT-GTP (CHEBI:145576) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) |
| Incoming Relation(s) |
| MANT-GTP (CHEBI:145560) has part 3'-MANT-GTP (CHEBI:145576) |
| IUPAC Name |
|---|
| 3'-O-[2-(methylamino)benzoyl]guanosine 5'-(tetrahydrogen triphosphate) |
| Synonym | Source |
|---|---|
| 3'-O-(N-methylanthraniloyl)guanosine triphosphate | ChEBI |
| Citations |
|---|