EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H14NO.C8H5Cl2O3 |
| Net Charge | 0 |
| Average Mass | 324.204 |
| Monoisotopic Mass | 323.06911 |
| SMILES | C[N+](C)(C)CCO.O=C([O-])COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2O3.C5H14NO/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-6(2,3)4-5-7/h1-3H,4H2,(H,11,12);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | OXJISOJFVQITNG-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-D choline (CHEBI:145558) has part (2,4-dichlorophenoxy)acetate (CHEBI:19351) |
| 2,4-D choline (CHEBI:145558) has role agrochemical (CHEBI:33286) |
| 2,4-D choline (CHEBI:145558) has role phenoxy herbicide (CHEBI:60575) |
| 2,4-D choline (CHEBI:145558) has role synthetic auxin (CHEBI:26841) |
| 2,4-D choline (CHEBI:145558) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 2-hydroxy-N,N,N-trimethylethanaminium (2,4-dichlorophenoxy)acetate |
| Synonyms | Source |
|---|---|
| 2,4-D choline salt | ChemIDplus |
| 2-hydroxy-N,N,N-trimethylethan-1-aminium (2,4-dichlorophenoxy)acetate | IUPAC |
| (2-hydroxyethyl)trimethylammonium (2,4-dichlorophenoxy)acetate | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Enlist Duo | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| /derivatives/2,4-d-choline | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18511959 | Reaxys |
| CAS:1048373-72-3 | ChemIDplus |
| Citations |
|---|