EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29N7O2 |
| Net Charge | 0 |
| Average Mass | 471.565 |
| Monoisotopic Mass | 471.23827 |
| SMILES | C[C@H]1CC[C@H](n2c3cnccc3c3cnc(Nc4ccc5c(n4)CCN(C(=O)CO)C5)nc32)CC1 |
| InChI | InChI=1S/C26H29N7O2/c1-16-2-5-18(6-3-16)33-22-13-27-10-8-19(22)20-12-28-26(31-25(20)33)30-23-7-4-17-14-32(24(35)15-34)11-9-21(17)29-23/h4,7-8,10,12-13,16,18,34H,2-3,5-6,9,11,14-15H2,1H3,(H,28,29,30,31)/t16-,18- |
| InChIKey | BBUVDDPUURMFOX-SAABIXHNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AMG-925 (CHEBI:145537) has role antineoplastic agent (CHEBI:35610) |
| AMG-925 (CHEBI:145537) has role apoptosis inducer (CHEBI:68495) |
| AMG-925 (CHEBI:145537) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| AMG-925 (CHEBI:145537) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| AMG-925 (CHEBI:145537) is a naphthyridine derivative (CHEBI:73539) |
| AMG-925 (CHEBI:145537) is a organic heterotricyclic compound (CHEBI:26979) |
| AMG-925 (CHEBI:145537) is a primary α-hydroxy ketone (CHEBI:139590) |
| AMG-925 (CHEBI:145537) is a secondary amino compound (CHEBI:50995) |
| AMG-925 (CHEBI:145537) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-hydroxy-1-[2-{[9-(trans-4-methylcyclohexyl)-9H-pyrido[4',3':4,5]pyrrolo[2,3-d]pyrimidin-2-yl]amino}-7,8-dihydro-1,6-naphthyridin-6(5H)-yl]ethanone |
| Synonyms | Source |
|---|---|
| 2-hydroxy-1-[2-({9-[(1r,4r)-4-methylcyclohexyl]-9H-pyrido[4',3':4,5]pyrrolo[2,3-d]pyrimidin-2-yl}amino)-7,8-dihydro-1,6-naphthyridin-6(5H)-yl]ethan-1-one | IUPAC |
| AMG 925 | ChEBI |
| AMG-925 | ChEBI |
| AMG925 | ChEBI |
| FLX 925 | ChEBI |
| FLX-925 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US8623885 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1401033-86-0 | ChemIDplus |
| Citations |
|---|