EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N5O4S |
| Net Charge | 0 |
| Average Mass | 443.529 |
| Monoisotopic Mass | 443.16273 |
| SMILES | NS(=O)(=O)OC[C@@H]1C[C@@H](n2ccc3c(N[C@H]4CCc5ccccc54)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C21H25N5O4S/c22-31(28,29)30-11-14-9-15(10-19(14)27)26-8-7-17-20(23-12-24-21(17)26)25-18-6-5-13-3-1-2-4-16(13)18/h1-4,7-8,12,14-15,18-19,27H,5-6,9-11H2,(H2,22,28,29)(H,23,24,25)/t14-,15+,18-,19-/m0/s1 |
| InChIKey | MPUQHZXIXSTTDU-QXGSTGNESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pevonedistat (CHEBI:145535) has role antineoplastic agent (CHEBI:35610) |
| pevonedistat (CHEBI:145535) has role apoptosis inducer (CHEBI:68495) |
| pevonedistat (CHEBI:145535) is a cyclopentanols (CHEBI:23495) |
| pevonedistat (CHEBI:145535) is a indanes (CHEBI:46940) |
| pevonedistat (CHEBI:145535) is a pyrrolopyrimidine (CHEBI:38670) |
| pevonedistat (CHEBI:145535) is a secondary amino compound (CHEBI:50995) |
| pevonedistat (CHEBI:145535) is a sulfamidate (CHEBI:51872) |
| IUPAC Name |
|---|
| [(1S,2S,4R)-4-{4-[(1S)-2,3-dihydro-1H-inden-1-ylamino]-7H-pyrrolo[2,3-d]pyrimidin-7-yl}-2-hydroxycyclopentyl]methyl sulfamate |
| INNs | Source |
|---|---|
| pevonedistat | WHO MedNet |
| pevonedistat | WHO MedNet |
| pévonédistat | WHO MedNet |
| pevonedistatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| [(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-2-hydroxy-cyclopentyl]methyl sulfamate | PDBeChem |
| MLN 4924 | ChemIDplus |
| MLN-4924 | LINCS |
| MLN4924 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| B39 | PDBeChem |
| D10413 | KEGG DRUG |
| DB11759 | DrugBank |
| LSM-6263 | LINCS |
| Pevonedistat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:905579-51-3 | ChemIDplus |
| Citations |
|---|