EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O6S |
| Net Charge | 0 |
| Average Mass | 382.438 |
| Monoisotopic Mass | 382.11986 |
| SMILES | CCn1ncc(C(=O)c2ccc(S(C)(=O)=O)c(OCCOC)c2C)c1O |
| InChI | InChI=1S/C17H22N2O6S/c1-5-19-17(21)13(10-18-19)15(20)12-6-7-14(26(4,22)23)16(11(12)2)25-9-8-24-3/h6-7,10,21H,5,8-9H2,1-4H3 |
| InChIKey | AOWROGWEYJVWCJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MT-2153 (CHEBI:145514) has role herbicide (CHEBI:24527) |
| MT-2153 (CHEBI:145514) has role metabolite (CHEBI:25212) |
| MT-2153 (CHEBI:145514) is a aromatic alcohol (CHEBI:33854) |
| MT-2153 (CHEBI:145514) is a aromatic ether (CHEBI:35618) |
| MT-2153 (CHEBI:145514) is a aromatic ketone (CHEBI:76224) |
| MT-2153 (CHEBI:145514) is a benzoylpyrazole (CHEBI:38318) |
| MT-2153 (CHEBI:145514) is a pyrazole pesticide (CHEBI:38601) |
| MT-2153 (CHEBI:145514) is a sulfone (CHEBI:35850) |
| MT-2153 (CHEBI:145514) is a toluenes (CHEBI:27024) |
| Incoming Relation(s) |
| tolpyralate (CHEBI:145506) has functional parent MT-2153 (CHEBI:145514) |
| IUPAC Name |
|---|
| (1-ethyl-5-hydroxy-1H-pyrazol-4-yl)[3-(2-methoxyethoxy)-2-methyl-4-(methylsulfonyl)phenyl]methanone |
| Synonym | Source |
|---|---|
| (1-ethyl-5-hydroxypyrazol-4-yl)[4-mesyl-3-(2-methoxyethoxy)-2-methylphenyl]mthanone | ChEBI |
| Citations |
|---|