EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2O9S |
| Net Charge | 0 |
| Average Mass | 484.527 |
| Monoisotopic Mass | 484.15155 |
| SMILES | CCn1ncc(C(=O)c2ccc(S(C)(=O)=O)c(OCCOC)c2C)c1O[C@H](C)OC(=O)OC |
| InChI | InChI=1S/C21H28N2O9S/c1-7-23-20(31-14(3)32-21(25)29-5)16(12-22-23)18(24)15-8-9-17(33(6,26)27)19(13(15)2)30-11-10-28-4/h8-9,12,14H,7,10-11H2,1-6H3/t14-/m0/s1 |
| InChIKey | GHLCSCRDVVEUQD-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Application: | proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-tolpyralate (CHEBI:145510) has role proherbicide (CHEBI:136646) |
| (S)-tolpyralate (CHEBI:145510) is a 1-({1-ethyl-4-[3-(2-methoxyethoxy)-2-methyl-4-(methylsulfonyl)benzoyl]-1H-pyrazol-5-yl}oxy)ethyl methyl carbonate (CHEBI:145511) |
| (S)-tolpyralate (CHEBI:145510) is enantiomer of (R)-tolpyralate (CHEBI:145509) |
| Incoming Relation(s) |
| tolpyralate (CHEBI:145506) has part (S)-tolpyralate (CHEBI:145510) |
| (R)-tolpyralate (CHEBI:145509) is enantiomer of (S)-tolpyralate (CHEBI:145510) |
| IUPAC Name |
|---|
| (1S)-1-({1-ethyl-4-[3-(2-methoxyethoxy)-2-methyl-4-(methylsulfonyl)benzoyl]-1H-pyrazol-5-yl}oxy)ethyl methyl carbonate |