EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30NO3 |
| Net Charge | +1 |
| Average Mass | 380.508 |
| Monoisotopic Mass | 380.22202 |
| SMILES | [H][C@]1(CC2CC[NH+](Cc3ccccc3)CC2)Cc2cc(OC)c(OC)cc2C1=O |
| InChI | InChI=1S/C24H29NO3/c1-27-22-14-19-13-20(24(26)21(19)15-23(22)28-2)12-17-8-10-25(11-9-17)16-18-6-4-3-5-7-18/h3-7,14-15,17,20H,8-13,16H2,1-2H3/p+1/t20-/m0/s1 |
| InChIKey | ADEBPBSSDYVVLD-FQEVSTJZSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-donepezil(1+) (CHEBI:145503) is a piperidinium ion (CHEBI:48633) |
| (S)-donepezil(1+) (CHEBI:145503) is conjugate acid of (S)-donepezil (CHEBI:53290) |
| (S)-donepezil(1+) (CHEBI:145503) is enantiomer of (R)-donepezil(1+) (CHEBI:145502) |
| Incoming Relation(s) |
| (S)-donepezil hydrochloride (CHEBI:145505) has part (S)-donepezil(1+) (CHEBI:145503) |
| (S)-donepezil (CHEBI:53290) is conjugate base of (S)-donepezil(1+) (CHEBI:145503) |
| (R)-donepezil(1+) (CHEBI:145502) is enantiomer of (S)-donepezil(1+) (CHEBI:145503) |
| IUPAC Name |
|---|
| (2S)-1-benzyl-4-[(5,6-dimethoxy-1-oxo-2,3-dihydro-1H-inden-2-yl)methyl]piperidinium |
| Synonym | Source |
|---|---|
| (S)-donepezil cation | ChEBI |
| Citations |
|---|