EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O9S |
| Net Charge | 0 |
| Average Mass | 260.220 |
| Monoisotopic Mass | 260.02020 |
| SMILES | O=S(=O)(O)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O9S/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-10H,1H2,(H,11,12,13)/t2-,3-,4+,5-,6?/m1/s1 |
| InChIKey | OKUVUONOJCDUJY-GASJEMHNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucopyranose 6-sulfate (CHEBI:145436) has functional parent D-glucopyranose (CHEBI:4167) |
| D-glucopyranose 6-sulfate (CHEBI:145436) is a monosaccharide sulfate (CHEBI:24589) |
| D-glucopyranose 6-sulfate (CHEBI:145436) is conjugate acid of D-glucopyranose 6-sulfate(1−) (CHEBI:145427) |
| Incoming Relation(s) |
| D-glucopyranose 6-sulfate(1−) (CHEBI:145427) is conjugate base of D-glucopyranose 6-sulfate (CHEBI:145436) |