EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12ClN3O4S2 |
| Net Charge | 0 |
| Average Mass | 385.854 |
| Monoisotopic Mass | 384.99578 |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)Nc2cccc3c(Cl)cnc23)cc1 |
| InChI | InChI=1S/C14H12ClN3O4S2/c15-12-8-17-14-11(12)2-1-3-13(14)18-24(21,22)10-6-4-9(5-7-10)23(16,19)20/h1-8,17-18H,(H2,16,19,20) |
| InChIKey | SETFNECMODOHTO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 4.2.1.1 (carbonic anhydrase) inhibitor An EC 4.2.1.* (hydro-lyases) inhibitor that interferes with the action of carbonic anhydrase (EC 4.2.1.1). Such compounds reduce the secretion of H+ ions by the proximal kidney tubule. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indisulam (CHEBI:145431) has role antineoplastic agent (CHEBI:35610) |
| indisulam (CHEBI:145431) has role EC 4.2.1.1 (carbonic anhydrase) inhibitor (CHEBI:23018) |
| indisulam (CHEBI:145431) is a chloroindole (CHEBI:52508) |
| indisulam (CHEBI:145431) is a organochlorine compound (CHEBI:36683) |
| indisulam (CHEBI:145431) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-(3-chloro-1H-indol-7-yl)benzene-1,4-disulfonamide |
| INNs | Source |
|---|---|
| indisulam | WHO MedNet |
| indisulam | WHO MedNet |
| indisulamum | WHO MedNet |
| indisulam | WHO MedNet |
| Synonyms | Source |
|---|---|
| E-7070 | DrugBank |
| E7070 | DrugBank |
| N1-(3-chloro-1H-indol-7-yl)benzene-1,4-disulfonamide | IUPAC |
| N-(3-chloro-1H-indol-7-yl)-4-sulfamoylbenzenesulfonamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:165668-41-7 | ChemIDplus |
| Citations |
|---|