EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N6O |
| Net Charge | 0 |
| Average Mass | 374.448 |
| Monoisotopic Mass | 374.18551 |
| SMILES | CN1CC[C@@H](NC(=O)Nc2ccc(C#N)cc2)C[C@@H]1c1nc2ccccc2n1 |
| InChI | InChI=1S/C21H22N6O/c1-27-11-10-16(24-21(28)23-15-8-6-14(13-22)7-9-15)12-19(27)20-25-17-4-2-3-5-18(17)26-20/h2-9,16,19H,10-12H2,1H3,(H,25,26)(H2,23,24,28)/t16-,19-/m1/s1 |
| InChIKey | SFNSLLSYNZWZQG-VQIMIIECSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | SMO receptor antagonist An antagonist that interferes with the action of smoothened (SMO) receptor. Hedgehog signaling pathway inhibitor Any pathway inhibitor that inhibits the Hedgehog signalling pathway. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glasdegib (CHEBI:145428) has role antineoplastic agent (CHEBI:35610) |
| glasdegib (CHEBI:145428) has role Hedgehog signaling pathway inhibitor (CHEBI:140921) |
| glasdegib (CHEBI:145428) has role SMO receptor antagonist (CHEBI:66908) |
| glasdegib (CHEBI:145428) is a benzimidazoles (CHEBI:22715) |
| glasdegib (CHEBI:145428) is a nitrile (CHEBI:18379) |
| glasdegib (CHEBI:145428) is a phenylureas (CHEBI:134043) |
| glasdegib (CHEBI:145428) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 1-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-3-(4-cyanophenyl)urea |
| INNs | Source |
|---|---|
| glasdegibum | WHO MedNet |
| glasdegib | WHO MedNet |
| glasdegib | WHO MedNet |
| glasdégib | WHO MedNet |
| Synonyms | Source |
|---|---|
| N-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-N'-(4-cyanophenyl)urea | IUPAC |
| PF-04449913 | DrugBank |
| PF-4449913 | DrugBank |
| PF-913 | ChEBI |
| Brand Name | Source |
|---|---|
| Daurismo | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1095173-27-5 | ChemIDplus |
| Citations |
|---|