EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24NO8S.Na |
| Net Charge | 0 |
| Average Mass | 473.479 |
| Monoisotopic Mass | 473.11203 |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(NCC(=O)[O-])c2)c(OC)c1.[Na+] |
| InChI | InChI=1S/C21H25NO8S.Na/c1-27-15-10-19(29-3)16(20(11-15)30-4)7-8-31(25,26)13-14-5-6-18(28-2)17(9-14)22-12-21(23)24;/h5-11,22H,12-13H2,1-4H3,(H,23,24);/q;+1/p-1/b8-7+; |
| InChIKey | VLQLUZFVFXYXQE-USRGLUTNSA-M |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.21 (polo kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of any polo kinase (EC 2.7.11.21). microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. |
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rigosertib sodium (CHEBI:145421) has part rigosertib(1−) (CHEBI:145422) |
| rigosertib sodium (CHEBI:145421) has role anti-anaemic agent (CHEBI:75835) |
| rigosertib sodium (CHEBI:145421) has role antineoplastic agent (CHEBI:35610) |
| rigosertib sodium (CHEBI:145421) has role apoptosis inducer (CHEBI:68495) |
| rigosertib sodium (CHEBI:145421) has role EC 2.7.11.21 (polo kinase) inhibitor (CHEBI:145425) |
| rigosertib sodium (CHEBI:145421) has role microtubule-destabilising agent (CHEBI:61951) |
| rigosertib sodium (CHEBI:145421) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium [2-methoxy-5-({[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonyl}methyl)anilino]acetate |
| Synonyms | Source |
|---|---|
| (E)-ON 01910.Na | ChEBI |
| novonex | ChemIDplus |
| ON 01910.Na | ChemIDplus |
| ON-01910.Na | ChEBI |
| ON 01910 sodium | ChEBI |
| ON-01910 sodium | ChEBI |
| Brand Name | Source |
|---|---|
| Estybon | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D10155 | KEGG DRUG |
| DBSALT002144 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:592542-60-4 | ChemIDplus |
| Citations |
|---|