EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N3O4S2 |
| Net Charge | 0 |
| Average Mass | 313.360 |
| Monoisotopic Mass | 313.01910 |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ncc(CC(=O)O)s2)cc1 |
| InChI | InChI=1S/C11H11N3O4S2/c12-7-1-3-9(4-2-7)20(17,18)14-11-13-6-8(19-11)5-10(15)16/h1-4,6H,5,12H2,(H,13,14)(H,15,16) |
| InChIKey | NYMIDEKPLFFDQW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-{[(4-aminophenyl)sulfonyl]amino}-1,3-thiazol-5-yl)acetic acid (CHEBI:145418) has role hapten (CHEBI:59174) |
| (2-{[(4-aminophenyl)sulfonyl]amino}-1,3-thiazol-5-yl)acetic acid (CHEBI:145418) is a monocarboxylic acid (CHEBI:25384) |
| (2-{[(4-aminophenyl)sulfonyl]amino}-1,3-thiazol-5-yl)acetic acid (CHEBI:145418) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| {2-[(4-aminobenzene-1-sulfonyl)amino]-1,3-thiazol-5-yl}acetic acid |
| Synonym | Source |
|---|---|
| 2-[2-[(4-aminophenyl)sulfonylamino]-1,3-thiazol-5-yl]acetic acid | ChEBI |
| Citations |
|---|