EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO8S |
| Net Charge | 0 |
| Average Mass | 451.497 |
| Monoisotopic Mass | 451.13009 |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(NCC(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C21H25NO8S/c1-27-15-10-19(29-3)16(20(11-15)30-4)7-8-31(25,26)13-14-5-6-18(28-2)17(9-14)22-12-21(23)24/h5-11,22H,12-13H2,1-4H3,(H,23,24)/b8-7+ |
| InChIKey | OWBFCJROIKNMGD-BQYQJAHWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. EC 2.7.11.21 (polo kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of any polo kinase (EC 2.7.11.21). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rigosertib (CHEBI:145417) has role antineoplastic agent (CHEBI:35610) |
| rigosertib (CHEBI:145417) has role apoptosis inducer (CHEBI:68495) |
| rigosertib (CHEBI:145417) has role EC 2.7.11.21 (polo kinase) inhibitor (CHEBI:145425) |
| rigosertib (CHEBI:145417) has role microtubule-destabilising agent (CHEBI:61951) |
| rigosertib (CHEBI:145417) is a N-[2-methoxy-5-({[2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonyl}methyl)phenyl]glycine (CHEBI:124939) |
| rigosertib (CHEBI:145417) is conjugate acid of rigosertib(1−) (CHEBI:145422) |
| Incoming Relation(s) |
| rigosertib(1−) (CHEBI:145422) is conjugate base of rigosertib (CHEBI:145417) |
| IUPAC Name |
|---|
| N-[2-methoxy-5-({[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonyl}methyl)phenyl]glycine |
| INNs | Source |
|---|---|
| rigosertib | WHO MedNet |
| rigosertib | WHO MedNet |
| rigosertibum | WHO MedNet |
| rigosertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| ON-01910 | DrugBank |
| ON 01910 | DrugBank |
| [2-methoxy-5-({[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonyl}methyl)anilino]acetic acid | ChEBI |
| (E)-ON 01910 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB12146 | DrugBank |
| D10154 | KEGG DRUG |
| Rigosertib | Wikipedia |
| 6FS | PDBeChem |
| LSM-44531 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:592542-59-1 | ChemIDplus |
| Citations |
|---|