EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2O4S |
| Net Charge | 0 |
| Average Mass | 334.397 |
| Monoisotopic Mass | 334.09873 |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccc(CCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H18N2O4S/c17-13-6-10-15(11-7-13)23(21,22)18-14-8-4-12(5-9-14)2-1-3-16(19)20/h4-11,18H,1-3,17H2,(H,19,20) |
| InChIKey | QRJXAOKWKYCSHS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(4-{[(4-aminophenyl)sulfonyl]amino}phenyl)butanoic acid (CHEBI:145415) has role hapten (CHEBI:59174) |
| 4-(4-{[(4-aminophenyl)sulfonyl]amino}phenyl)butanoic acid (CHEBI:145415) is a monocarboxylic acid (CHEBI:25384) |
| 4-(4-{[(4-aminophenyl)sulfonyl]amino}phenyl)butanoic acid (CHEBI:145415) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-{4-[(4-aminobenzene-1-sulfonyl)amino]phenyl}butanoic acid |
| Synonyms | Source |
|---|---|
| 4-[4-[(4-aminophenyl)sulfonylamino]phenyl]butanoic acid | ChEBI |
| 4-(4-{[(4-aminophenyl)sulfonyl]amino}phenyl)butyric acid | ChEBI |
| Citations |
|---|