EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14Cl2O4 |
| Net Charge | 0 |
| Average Mass | 341.190 |
| Monoisotopic Mass | 340.02691 |
| SMILES | COC(=O)[C@@H](C)Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2O4/c1-10(16(19)20-2)21-12-4-6-13(7-5-12)22-15-8-3-11(17)9-14(15)18/h3-10H,1-2H3/t10-/m1/s1 |
| InChIKey | BACHBFVBHLGWSL-SNVBAGLBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-diclofop-methyl (CHEBI:145413) is a methyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate (CHEBI:145412) |
| (R)-diclofop-methyl (CHEBI:145413) is enantiomer of (S)-diclofop-methyl (CHEBI:145414) |
| Incoming Relation(s) |
| diclofop-methyl (CHEBI:4510) has part (R)-diclofop-methyl (CHEBI:145413) |
| (S)-diclofop-methyl (CHEBI:145414) is enantiomer of (R)-diclofop-methyl (CHEBI:145413) |
| IUPAC Name |
|---|
| methyl (2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate |
| Registry Numbers | Sources |
|---|---|
| CAS:71283-65-3 | ChemIDplus |
| Citations |
|---|