EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O4S |
| Net Charge | 0 |
| Average Mass | 258.299 |
| Monoisotopic Mass | 258.06743 |
| SMILES | Nc1ccc(S(=O)(=O)NCCCC(=O)O)cc1 |
| InChI | InChI=1S/C10H14N2O4S/c11-8-3-5-9(6-4-8)17(15,16)12-7-1-2-10(13)14/h3-6,12H,1-2,7,11H2,(H,13,14) |
| InChIKey | PLVIOWGDVCMNAH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-{[(4-aminophenyl)sulfonyl]amino}butanoic acid (CHEBI:145409) has role hapten (CHEBI:59174) |
| 4-{[(4-aminophenyl)sulfonyl]amino}butanoic acid (CHEBI:145409) is a monocarboxylic acid (CHEBI:25384) |
| 4-{[(4-aminophenyl)sulfonyl]amino}butanoic acid (CHEBI:145409) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-[(4-aminobenzene-1-sulfonyl)amino]butanoic acid |
| Synonyms | Source |
|---|---|
| 4-{[(4-aminophenyl)sulfonyl]amino}butyric acid | ChEBI |
| 4-{[(4-Aminophenyl)sulfonyl]amino}butansäure | ChEBI |
| acide 4-{[(4-aminophényl)sulfonyl]amino}butanoïque | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:457942-90-4 | ChemSpider |
| Citations |
|---|