EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N4O3S |
| Net Charge | 0 |
| Average Mass | 294.336 |
| Monoisotopic Mass | 294.07866 |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(N)cc2)nn1 |
| InChI | InChI=1S/C12H14N4O3S/c1-2-19-12-8-7-11(14-15-12)16-20(17,18)10-5-3-9(13)4-6-10/h3-8H,2,13H2,1H3,(H,14,16) |
| InChIKey | FFJIWWBSBCOKLS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfaethoxypyridazine (CHEBI:145407) has role antibacterial agent (CHEBI:33282) |
| sulfaethoxypyridazine (CHEBI:145407) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-amino-N-(6-ethoxypyridazin-3-yl)benzene-1-sulfonamide |
| Synonyms | Source |
|---|---|
| 4-amino-N-(6-ethoxypyridazin-3-yl)benzenesulfonamide | IUPAC |
| 4-amino-N-(6-ethoxy-3-pyridazinyl)benzenesulfonamide | ChemIDplus |
| N1-(6-ethoxy-3-pyridazinyl)sulfanilamide | ChemIDplus |
| N1-(6-ethoxypyridazin-3-yl)sulphanilamide | ChemIDplus |
| Citations |
|---|