EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12Cl2O4 |
| Net Charge | 0 |
| Average Mass | 327.163 |
| Monoisotopic Mass | 326.01126 |
| SMILES | C[C@H](Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C15H12Cl2O4/c1-9(15(18)19)20-11-3-5-12(6-4-11)21-14-7-2-10(16)8-13(14)17/h2-9H,1H3,(H,18,19)/t9-/m0/s1 |
| InChIKey | OOLBCHYXZDXLDS-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-diclofop (CHEBI:145404) is a 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid (CHEBI:145406) |
| (S)-diclofop (CHEBI:145404) is enantiomer of (R)-diclofop (CHEBI:145403) |
| Incoming Relation(s) |
| diclofop (CHEBI:81909) has part (S)-diclofop (CHEBI:145404) |
| (R)-diclofop (CHEBI:145403) is enantiomer of (S)-diclofop (CHEBI:145404) |
| IUPAC Name |
|---|
| (2S)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid |
| Synonyms | Source |
|---|---|
| (S)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid | ChEBI |
| (−)-diclofop | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:75021-71-5 | ChEBI |
| Citations |
|---|