EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13O9PR |
| Net Charge | -1 |
| Average Mass (excl. R groups) | 272.147 |
| Monoisotopic Mass (excl. R groups) | 272.02972 |
| SMILES | *C(=O)O[C@H](CO)COP(=O)([O-])OCC(O)CO |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-acyl-sn-glycero-3-phosphoglycerol(1−) (CHEBI:145393) is a 2-acylglycero-3-phospho-1'-glycerol(1−) (CHEBI:78212) |
| 2-acyl-sn-glycero-3-phosphoglycerol(1−) (CHEBI:145393) is conjugate base of 2-acyl-sn-glycero-3-phosphoglycerol (CHEBI:27923) |
| Incoming Relation(s) |
| 2-acyl-sn-glycero-3-phospho-(1'-sn-glycerol)(1−) (CHEBI:76528) is a 2-acyl-sn-glycero-3-phosphoglycerol(1−) (CHEBI:145393) |
| 2-acyl-sn-glycero-3-phosphoglycerol (CHEBI:27923) is conjugate acid of 2-acyl-sn-glycero-3-phosphoglycerol(1−) (CHEBI:145393) |
| Synonym | Source |
|---|---|
| 1-lyso-2-acyl-sn-glycero-3-phosphoglycerol(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| a 2-acyl-sn-glycero-3-phosphoglycerol | UniProt |
| Citations |
|---|