EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15ClF3N5 |
| Net Charge | 0 |
| Average Mass | 417.822 |
| Monoisotopic Mass | 417.09681 |
| SMILES | FC(F)(F)c1ccc(CNc2ccc(Cc3cnc4ncc(Cl)cc34)cn2)cn1 |
| InChI | InChI=1S/C20H15ClF3N5/c21-15-6-16-14(10-28-19(16)29-11-15)5-12-2-4-18(26-7-12)27-9-13-1-3-17(25-8-13)20(22,23)24/h1-4,6-8,10-11H,5,9H2,(H,26,27)(H,28,29) |
| InChIKey | JGWRKYUXBBNENE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pexidartinib (CHEBI:145373) has role antineoplastic agent (CHEBI:35610) |
| pexidartinib (CHEBI:145373) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| pexidartinib (CHEBI:145373) is a aminopyridine (CHEBI:38207) |
| pexidartinib (CHEBI:145373) is a organochlorine compound (CHEBI:36683) |
| pexidartinib (CHEBI:145373) is a organofluorine compound (CHEBI:37143) |
| pexidartinib (CHEBI:145373) is a pyrrolopyridine (CHEBI:46771) |
| pexidartinib (CHEBI:145373) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 5-[(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-N-{[6-(trifluoromethyl)pyridin-3-yl]methyl}pyridin-2-amine |
| INNs | Source |
|---|---|
| pexidartinib | WHO MedNet |
| pexidartinib | WHO MedNet |
| pexidartinib | WHO MedNet |
| pexidartinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| CML-261 | DrugBank |
| PLX-3397 | DrugBank |
| PLX3397 | DrugBank |
| Brand Name | Source |
|---|---|
| Turalio | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D11270 | KEGG DRUG |
| DB12978 | DrugBank |
| P31 | PDBeChem |
| Pexidartinib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1029044-16-3 | ChemIDplus |
| Citations |
|---|