EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15BrF2N4O3 |
| Net Charge | 0 |
| Average Mass | 441.232 |
| Monoisotopic Mass | 440.02956 |
| SMILES | Cn1cnc2c(F)c(Nc3ccc(Br)cc3F)c(C(=O)NOCCO)cc21 |
| InChI | InChI=1S/C17H15BrF2N4O3/c1-24-8-21-16-13(24)7-10(17(26)23-27-5-4-25)15(14(16)20)22-12-3-2-9(18)6-11(12)19/h2-3,6-8,22,25H,4-5H2,1H3,(H,23,26) |
| InChIKey | ACWZRVQXLIRSDF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| binimetinib (CHEBI:145371) has role antineoplastic agent (CHEBI:35610) |
| binimetinib (CHEBI:145371) has role apoptosis inducer (CHEBI:68495) |
| binimetinib (CHEBI:145371) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| binimetinib (CHEBI:145371) is a benzimidazoles (CHEBI:22715) |
| binimetinib (CHEBI:145371) is a bromobenzenes (CHEBI:37149) |
| binimetinib (CHEBI:145371) is a hydroxamic acid ester (CHEBI:75606) |
| binimetinib (CHEBI:145371) is a monofluorobenzenes (CHEBI:83575) |
| binimetinib (CHEBI:145371) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 5-(4-bromo-2-fluoroanilino)-4-fluoro-N-(2-hydroxyethoxy)-1-methyl-1H-benzimidazole-6-carboxamide |
| INNs | Source |
|---|---|
| binimetinib | WHO MedNet |
| binimetinib | WHO MedNet |
| binimétinib | WHO MedNet |
| binimetinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-[(4-bromo-2-fluorophenyl)amino]-4-fluoro-N-(2-hydroxyethoxy)-1-methyl-1H-1,3-benzodiazole-6-carboxamide | DrugBank |
| 5-[(4-bromo-2-fluorophenyl)amino]-4-fluoro-N-(2-hydroxyethoxy)-1-methyl-1H-benzimidazole-6-carboxamide | ChEBI |
| ARRY 162 | ChemIDplus |
| ARRY-162 | DrugBank |
| ARRY 438162 | ChemIDplus |
| ARRY-438162 | DrugBank |
| Brand Name | Source |
|---|---|
| Mektovi | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| Binimetinib | Wikipedia |
| D10604 | KEGG DRUG |
| DB11967 | DrugBank |
| LSM-45640 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:606143-89-9 | ChemIDplus |
| Citations |
|---|