EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29N5O2 |
| Net Charge | 0 |
| Average Mass | 443.551 |
| Monoisotopic Mass | 443.23213 |
| SMILES | CC1(COc2ccc3c(c2)ncn3-c2ccc3cccc(N4CCC(N)CC4)c3n2)COC1 |
| InChI | InChI=1S/C26H29N5O2/c1-26(14-32-15-26)16-33-20-6-7-22-21(13-20)28-17-31(22)24-8-5-18-3-2-4-23(25(18)29-24)30-11-9-19(27)10-12-30/h2-8,13,17,19H,9-12,14-16,27H2,1H3 |
| InChIKey | DYNHJHQFHQTFTP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crenolanib (CHEBI:145365) has role angiogenesis inhibitor (CHEBI:48422) |
| crenolanib (CHEBI:145365) has role antineoplastic agent (CHEBI:35610) |
| crenolanib (CHEBI:145365) has role apoptosis inducer (CHEBI:68495) |
| crenolanib (CHEBI:145365) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| crenolanib (CHEBI:145365) is a aminopiperidine (CHEBI:48588) |
| crenolanib (CHEBI:145365) is a aromatic ether (CHEBI:35618) |
| crenolanib (CHEBI:145365) is a benzimidazoles (CHEBI:22715) |
| crenolanib (CHEBI:145365) is a oxetanes (CHEBI:38784) |
| crenolanib (CHEBI:145365) is a quinolines (CHEBI:26513) |
| crenolanib (CHEBI:145365) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1-(2-{5-[(3-methyloxetan-3-yl)methoxy]-1H-benzimidazol-1-yl}quinolin-8-yl)piperidin-4-amine |
| INNs | Source |
|---|---|
| crenolanib | WHO MedNet |
| crenolanib | WHO MedNet |
| crénolanib | WHO MedNet |
| crenolanibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-[2-[5-[(3-methyl-3-oxetanyl)methoxy]-1-benzimidazolyl]-8-quinolyl]-4-piperidinamine | ChEBI |
| 1-[2-[5-[(3-methyl-3-oxetanyl)methoxy]-1H-benzimidazol-1-yl]-8-quinolinyl]-4-piperidinamine | ChEBI |
| 1-(2-{5-[(3-methyloxetan-3-yl)methoxy]-1H-1,3-benzodiazol-1-yl}quinolin-8-yl)piperidin-4-amine | ChEBI |
| 1-(2-(5-((3-methyloxetan-3-yl)methoxy)-1H-benzo-[d]imidazol-1-yl)quinolin-8-yl)piperidin-4-amine | ChEBI |
| ARO 002 | DrugBank |
| ARO-002 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 6T2 | PDBeChem |
| Crenolanib | Wikipedia |
| D10102 | KEGG DRUG |
| DB11832 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:670220-88-9 | ChemIDplus |
| Citations |
|---|