EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O8S |
| Net Charge | 0 |
| Average Mass | 244.221 |
| Monoisotopic Mass | 244.02529 |
| SMILES | O=S(=O)(O)C[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O8S/c7-3-2(1-15(11,12)13)14-6(10)5(9)4(3)8/h2-10H,1H2,(H,11,12,13)/t2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | QFBWOLBPVQLZEH-VFUOTHLCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-sulfo-β-D-quinovose (CHEBI:145348) is a 6-sulfo-D-quinovose (CHEBI:77198) |
| 6-sulfo-β-D-quinovose (CHEBI:145348) is conjugate acid of 6-sulfo-β-D-quinovose(1−) (CHEBI:142957) |
| Incoming Relation(s) |
| 6-sulfo-β-D-quinovose(1−) (CHEBI:142957) is conjugate base of 6-sulfo-β-D-quinovose (CHEBI:145348) |
| IUPAC Name |
|---|
| 6-deoxy-6-sulfo-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| 6-sulfo-β-quinovose | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-21686 | MetaCyc |
| Citations |
|---|