EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25NO4 |
| Net Charge | 0 |
| Average Mass | 343.423 |
| Monoisotopic Mass | 343.17836 |
| SMILES | COc1cc2c(cc1O)[C@H](Cc1ccc(OC)c(OC)c1)N(C)CC2 |
| InChI | InChI=1S/C20H25NO4/c1-21-8-7-14-11-19(24-3)17(22)12-15(14)16(21)9-13-5-6-18(23-2)20(10-13)25-4/h5-6,10-12,16,22H,7-9H2,1-4H3/t16-/m0/s1 |
| InChIKey | OKORHWXYDBSYNO-INIZCTEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-codamine (CHEBI:145336) is a aromatic ether (CHEBI:35618) |
| (S)-codamine (CHEBI:145336) is a benzylisoquinoline alkaloid (CHEBI:22750) |
| (S)-codamine (CHEBI:145336) is a benzyltetrahydroisoquinoline (CHEBI:26901) |
| (S)-codamine (CHEBI:145336) is a phenols (CHEBI:33853) |
| (S)-codamine (CHEBI:145336) is a tertiary amino compound (CHEBI:50996) |
| (S)-codamine (CHEBI:145336) is conjugate base of (S)-codamine(1+) (CHEBI:143148) |
| Incoming Relation(s) |
| (S)-codamine(1+) (CHEBI:143148) is conjugate acid of (S)-codamine (CHEBI:145336) |
| IUPAC Name |
|---|
| (1S)-1-(3,4-dimethoxybenzyl)-6-methoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-7-ol |
| Synonyms | Source |
|---|---|
| 7-desmethyllaudanosine | ChEBI |
| (+)-codamine | KNApSAcK |
| codamine | ChemIDplus |
| (S)-1-[(3,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-6-methoxy-2-methylisoquinolin-7-ol | ChemIDplus |
| (S)-(+)-codamine | KNApSAcK |
| L-(+)-codamine | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00025654 | KNApSAcK |
| CPD-22271 | MetaCyc |
| FDB013109 | FooDB |
| HMDB0034593 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:21040-59-5 | ChemIDplus |
| Citations |
|---|