EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N2O5 |
| Net Charge | 0 |
| Average Mass | 410.470 |
| Monoisotopic Mass | 410.18417 |
| SMILES | [H][C@@]12N3CC[C@]14C(=C(C(=O)OC)C[C@]2([C@@H](C)OC(C)=O)[C@H]1O[C@H]1C3)Nc1ccccc14 |
| InChI | InChI=1S/C23H26N2O5/c1-12(29-13(2)26)23-10-14(20(27)28-3)18-22(15-6-4-5-7-16(15)24-18)8-9-25(21(22)23)11-17-19(23)30-17/h4-7,12,17,19,21,24H,8-11H2,1-3H3/t12-,17+,19+,21-,22+,23+/m1/s1 |
| InChIKey | UHJSNZNSAVJLSA-TZQKRGQNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-O-acetylhörhammericine (CHEBI:145333) has functional parent hörhammericine (CHEBI:5765) |
| 19-O-acetylhörhammericine (CHEBI:145333) is a Aspidosperma alkaloid (CHEBI:142772) |
| 19-O-acetylhörhammericine (CHEBI:145333) is a acetate ester (CHEBI:47622) |
| 19-O-acetylhörhammericine (CHEBI:145333) is a epoxide (CHEBI:32955) |
| 19-O-acetylhörhammericine (CHEBI:145333) is a methyl ester (CHEBI:25248) |
| 19-O-acetylhörhammericine (CHEBI:145333) is a organic heterohexacyclic compound (CHEBI:51914) |
| 19-O-acetylhörhammericine (CHEBI:145333) is a secondary amino compound (CHEBI:50995) |
| 19-O-acetylhörhammericine (CHEBI:145333) is a tertiary amino compound (CHEBI:50996) |
| 19-O-acetylhörhammericine (CHEBI:145333) is conjugate base of 19-O-acetylhörhammericine(1+) (CHEBI:144376) |
| Incoming Relation(s) |
| 19-O-acetylhörhammericine(1+) (CHEBI:144376) is conjugate acid of 19-O-acetylhörhammericine (CHEBI:145333) |
| IUPAC Name |
|---|
| methyl (20R)-20-acetoxy-5α,6α,7α,12β,19α-2,3-didehydro-6,7-epoxyaspidospermidine-3-carboxylate |
| Citations |
|---|