EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O4 |
| Net Charge | 0 |
| Average Mass | 310.434 |
| Monoisotopic Mass | 310.21441 |
| SMILES | CC/C=C\CC(/C=C/C=C\CCCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H30O4/c1-2-3-11-14-17(22-21)15-12-9-7-5-4-6-8-10-13-16-18(19)20/h3,7,9,11-12,15,17,21H,2,4-6,8,10,13-14,16H2,1H3,(H,19,20)/b9-7-,11-3-,15-12+ |
| InChIKey | UYQGVDXDXBAABN-JDTPQGGVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z,11E,15Z)-13-hydroperoxyoctadecatrienoic acid (CHEBI:145300) is a hydroperoxyoctadecatrienoic acid (CHEBI:134615) |
| (9Z,11E,15Z)-13-hydroperoxyoctadecatrienoic acid (CHEBI:145300) is conjugate acid of (9Z,11E,15Z)-13-hydroperoxyoctadecatrienoate (CHEBI:144034) |
| Incoming Relation(s) |
| (9Z,11E,15Z)-13-hydroperoxyoctadecatrienoate (CHEBI:144034) is conjugate base of (9Z,11E,15Z)-13-hydroperoxyoctadecatrienoic acid (CHEBI:145300) |
| IUPAC Name |
|---|
| (9Z,11E,15Z)-13-hydroperoxyoctadeca-9,11,15-trienoic acid |
| Synonym | Source |
|---|---|
| 13-HpOTrE | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000110 | LIPID MAPS |
| Citations |
|---|