EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O3 |
| Net Charge | 0 |
| Average Mass | 270.413 |
| Monoisotopic Mass | 270.21949 |
| SMILES | O=C(O)CCCCCCC/C=C\CCCCCCO |
| InChI | InChI=1S/C16H30O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h1,3,17H,2,4-15H2,(H,18,19)/b3-1- |
| InChIKey | RPQJFAIEPUKQHK-IWQZZHSRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z)-16-hydroxyhexadec-9-enoic acid (CHEBI:145299) is a monounsaturated fatty acid (CHEBI:25413) |
| (9Z)-16-hydroxyhexadec-9-enoic acid (CHEBI:145299) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| (9Z)-16-hydroxyhexadec-9-enoic acid (CHEBI:145299) is conjugate acid of (9Z)-16-hydroxyhexadec-9-enoate (CHEBI:144048) |
| Incoming Relation(s) |
| (9Z)-16-hydroxyhexadec-9-enoate (CHEBI:144048) is conjugate base of (9Z)-16-hydroxyhexadec-9-enoic acid (CHEBI:145299) |
| IUPAC Name |
|---|
| (9Z)-16-hydroxyhexadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| 16-hydroxy-9Z-hexadecenoic acid | LIPID MAPS |
| 16-hydroxypalmitoleic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050193 | LIPID MAPS |
| Citations |
|---|